ChemNet > CAS > 163620-24-4 N-[5-(Trifluoromethyl)pyrid-2-yl]-N-methyl hydrazine
163620-24-4 N-[5-(Trifluoromethyl)pyrid-2-yl]-N-methyl hydrazine
| product Name |
N-[5-(Trifluoromethyl)pyrid-2-yl]-N-methyl hydrazine |
| CAS No |
163620-24-4 |
| Synonyms |
Trifluoromethylpyridylmethylhydrazine2; 1-Methyl-1-[5-(trifluoromethyl)-2-pyridyl]hydrazine; N-(7-chloroquinolin-4-yl)ethane-1,2-diamine; 1-(5-(trifluoromethyl)pyridin-2-yl)hydrazine |
| Molecular Formula |
C11H12ClN3 |
| Molecular Weight |
221.6861 |
| InChI |
InChI=1/C11H12ClN3/c12-8-1-2-9-10(15-6-4-13)3-5-14-11(9)7-8/h1-3,5,7H,4,6,13H2,(H,14,15) |
| Molecular Structure |
![163620-24-4 N-[5-(Trifluoromethyl)pyrid-2-yl]-N-methyl hydrazine](https://images-a.chemnet.com/suppliers/chembase/669/66978.gif)
|
| Density |
1.316g/cm3 |
| Melting point |
52-55℃ |
| Boiling point |
415°C at 760 mmHg |
| Refractive index |
1.697 |
| Flash point |
204.8°C |
| Vapour Pressur |
4.26E-07mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
| MSDS |
Material Safety Data Sheet
|
|
